C28H30N6OS — CID 3572107
2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-pyridin-4-ylethylideneamino)acetamide (PubChem CID 3572107) has the molecular formula C28H30N6OS and a molecular weight of 498.66 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-pyridin-4-ylethylideneamino)acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-pyridin-4-ylethylideneamino)acetamide |
|---|---|
| PubChem CID | 3572107 |
| Molecular Formula | C28H30N6OS |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-pyridin-4-ylethylideneamino)acetamide |
| SMILES | CC(=NNC(=O)CSc1nnc(-c2ccc(C(C)(C)C)cc2)n1-c1ccc(C)cc1)c1ccncc1 |
| InChI | InChI=1S/C28H30N6OS/c1-19-6-12-24(13-7-19)34-26(22-8-10-23(11-9-22)28(3,4)5)32-33-27(34)36-18-25(35)31-30-20(2)21-14-16-29-17-15-21/h6-17H,18H2,1-5H3,(H,31,35) |
| InChIKey | NGNWAIBNNMBHLU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|