C31H26ClN5OS — CID 6370792
2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]acetamide (PubChem CID 6370792) has the molecular formula C31H26ClN5OS and a molecular weight of 552.10 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6370792 |
| Molecular Formula | C31H26ClN5OS |
| Molecular Weight | 552.10 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CSc1nnc(-c2ccc(C)cc2)n1-c1ccc(Cl)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26ClN5OS/c1-21-8-10-26(11-9-21)30-35-36-31(37(30)28-18-16-27(32)17-19-28)39-20-29(38)34-33-22(2)23-12-14-25(15-13-23)24-6-4-3-5-7-24/h3-19H,20H2,1-2H3,(H,34,38)/b33-22- |
| InChIKey | MRKANLOAUOVHFF-NVMPUMLXSA-N |
| XLogP | 7.20 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.10 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|