C27H24ClN5O3S — CID 3133032
[4-[N-[[2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenyl] acetate (PubChem CID 3133032) has the molecular formula C27H24ClN5O3S and a molecular weight of 534.04 g/mol. Its IUPAC name is [4-[N-[[2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenyl] acetate.
| Compound Name | [4-[N-[[2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenyl] acetate |
|---|---|
| PubChem CID | 3133032 |
| Molecular Formula | C27H24ClN5O3S |
| Molecular Weight | 534.04 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | [4-[N-[[2-[[5-(4-chlorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(C)=NNC(=O)CSc2nnc(-c3ccc(Cl)cc3)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H24ClN5O3S/c1-17-4-12-23(13-5-17)33-26(21-6-10-22(28)11-7-21)31-32-27(33)37-16-25(35)30-29-18(2)20-8-14-24(15-9-20)36-19(3)34/h4-15H,16H2,1-3H3,(H,30,35) |
| InChIKey | DWMHZQWGAJWMFB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.04 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|