C24H18Cl3N5OS — CID 3780413
2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(2-chlorophenyl)ethylideneamino]acetamide (PubChem CID 3780413) has the molecular formula C24H18Cl3N5OS and a molecular weight of 530.87 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(2-chlorophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(2-chlorophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 3780413 |
| Molecular Formula | C24H18Cl3N5OS |
| Molecular Weight | 530.87 g/mol |
| Exact Mass | 529.03 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(2-chlorophenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C24H18Cl3N5OS/c1-15(20-4-2-3-5-21(20)27)28-29-22(33)14-34-24-31-30-23(16-6-8-17(25)9-7-16)32(24)19-12-10-18(26)11-13-19/h2-13H,14H2,1H3,(H,29,33) |
| InChIKey | VSQIYUUORCYLDJ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.87 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|