C22H24N6O5S — CID 3524049
2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3-nitrophenyl)ethylideneamino]acetamide (PubChem CID 3524049) has the molecular formula C22H24N6O5S and a molecular weight of 484.54 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3-nitrophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3-nitrophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 3524049 |
| Molecular Formula | C22H24N6O5S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[1-(3-nitrophenyl)ethylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)NN=C(C)c2cccc([N+](=O)[O-])c2)nnc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H24N6O5S/c1-5-27-21(16-9-10-18(32-3)19(12-16)33-4)25-26-22(27)34-13-20(29)24-23-14(2)15-7-6-8-17(11-15)28(30)31/h6-12H,5,13H2,1-4H3,(H,24,29) |
| InChIKey | ASLXCYBZCYNMNU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|