C16H15N7O3S — CID 126130660
2-[[4-ethyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-pyrimidin-2-ylacetamide (PubChem CID 126130660) has the molecular formula C16H15N7O3S and a molecular weight of 385.41 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-pyrimidin-2-ylacetamide.
| Compound Name | 2-[[4-ethyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 126130660 |
| Molecular Formula | C16H15N7O3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[[4-ethyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-pyrimidin-2-ylacetamide |
| SMILES | CCn1c(SCC(=O)Nc2ncccn2)nnc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N7O3S/c1-2-22-14(11-5-3-6-12(9-11)23(25)26)20-21-16(22)27-10-13(24)19-15-17-7-4-8-18-15/h3-9H,2,10H2,1H3,(H,17,18,19,24) |
| InChIKey | BODPTKNYPBRFRJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|