C18H16N6O5S — CID 21371340
2-[[4-ethyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 21371340) has the molecular formula C18H16N6O5S and a molecular weight of 428.43 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 21371340 |
| Molecular Formula | C18H16N6O5S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[[4-ethyl-5-(3-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2cccc([N+](=O)[O-])c2)nnc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N6O5S/c1-2-22-17(12-5-3-7-14(9-12)23(26)27)20-21-18(22)30-11-16(25)19-13-6-4-8-15(10-13)24(28)29/h3-10H,2,11H2,1H3,(H,19,25) |
| InChIKey | JOSVYDJJKPJOKL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 146.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|