C19H21N5O3S2 — CID 19719396
2-[[4-ethyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 19719396) has the molecular formula C19H21N5O3S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19719396 |
| Molecular Formula | C19H21N5O3S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-[[4-ethyl-5-(5-propylthiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | CCCc1cc(-c2nnc(SCC(=O)Nc3cccc([N+](=O)[O-])c3)n2CC)cs1 |
| InChI | InChI=1S/C19H21N5O3S2/c1-3-6-16-9-13(11-28-16)18-21-22-19(23(18)4-2)29-12-17(25)20-14-7-5-8-15(10-14)24(26)27/h5,7-11H,3-4,6,12H2,1-2H3,(H,20,25) |
| InChIKey | YUMLTNUEHOTUDZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|