C24H19BrN6O3S — CID 6134660
2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]acetamide (PubChem CID 6134660) has the molecular formula C24H19BrN6O3S and a molecular weight of 551.43 g/mol. Its IUPAC name is 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]acetamide.
| Compound Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6134660 |
| Molecular Formula | C24H19BrN6O3S |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-(3-nitrophenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CSc1nnc(-c2ccccc2)n1-c1ccc(Br)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H19BrN6O3S/c1-16(18-8-5-9-21(14-18)31(33)34)26-27-22(32)15-35-24-29-28-23(17-6-3-2-4-7-17)30(24)20-12-10-19(25)11-13-20/h2-14H,15H2,1H3,(H,27,32)/b26-16- |
| InChIKey | ZMMFCZNFVBZBKI-QQXSKIMKSA-N |
| XLogP | 5.24 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|