C19H20N6OS — CID 1125378
2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(1-pyridin-3-ylethylideneamino)acetamide (PubChem CID 1125378) has the molecular formula C19H20N6OS and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(1-pyridin-3-ylethylideneamino)acetamide.
| Compound Name | 2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(1-pyridin-3-ylethylideneamino)acetamide |
|---|---|
| PubChem CID | 1125378 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(1-pyridin-3-ylethylideneamino)acetamide |
| SMILES | CCn1c(SCC(=O)NN=C(C)c2cccnc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C19H20N6OS/c1-3-25-18(15-8-5-4-6-9-15)23-24-19(25)27-13-17(26)22-21-14(2)16-10-7-11-20-12-16/h4-12H,3,13H2,1-2H3,(H,22,26) |
| InChIKey | LWCHKDJIFYCYLJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|