C20H20FN5O4S — CID 41259307
N'-[2-[[5-(4-fluorophenyl)-4-[[(2S)-oxolan-2-yl]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide (PubChem CID 41259307) has the molecular formula C20H20FN5O4S and a molecular weight of 445.48 g/mol. Its IUPAC name is N'-[2-[[5-(4-fluorophenyl)-4-[[(2S)-oxolan-2-yl]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[5-(4-fluorophenyl)-4-[[(2S)-oxolan-2-yl]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 41259307 |
| Molecular Formula | C20H20FN5O4S |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N'-[2-[[5-(4-fluorophenyl)-4-[[(2S)-oxolan-2-yl]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccc(F)cc2)n1C[C@@H]1CCCO1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C20H20FN5O4S/c21-14-7-5-13(6-8-14)18-23-25-20(26(18)11-15-3-1-9-29-15)31-12-17(27)22-24-19(28)16-4-2-10-30-16/h2,4-8,10,15H,1,3,9,11-12H2,(H,22,27)(H,24,28)/t15-/m0/s1 |
| InChIKey | ZGBOSHAZIQBRIF-HNNXBMFYSA-N |
| XLogP | 2.41 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|