C22H21ClFN5O3S — CID 5200996
N'-[2-[[5-(4-chlorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide (PubChem CID 5200996) has the molecular formula C22H21ClFN5O3S and a molecular weight of 489.96 g/mol. Its IUPAC name is N'-[2-[[5-(4-chlorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[2-[[5-(4-chlorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 5200996 |
| Molecular Formula | C22H21ClFN5O3S |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | N'-[2-[[5-(4-chlorophenyl)-4-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)n1CC1CCCO1)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21ClFN5O3S/c23-16-7-3-14(4-8-16)20-26-28-22(29(20)12-18-2-1-11-32-18)33-13-19(30)25-27-21(31)15-5-9-17(24)10-6-15/h3-10,18H,1-2,11-13H2,(H,25,30)(H,27,31) |
| InChIKey | ZIZDARCKTZTARH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|