C15H15N5O3S2 — CID 7742486
N'-[2-[[4-methyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide (PubChem CID 7742486) has the molecular formula C15H15N5O3S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N'-[2-[[4-methyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-[[4-methyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 7742486 |
| Molecular Formula | C15H15N5O3S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N'-[2-[[4-methyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]furan-2-carbohydrazide |
| SMILES | Cn1c(Cc2cccs2)nnc1SCC(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C15H15N5O3S2/c1-20-12(8-10-4-3-7-24-10)16-19-15(20)25-9-13(21)17-18-14(22)11-5-2-6-23-11/h2-7H,8-9H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | XLTYWYVVCXULJC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|