C24H23N5O2S2 — CID 25476646
N'-[2-[[4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 25476646) has the molecular formula C24H23N5O2S2 and a molecular weight of 477.62 g/mol. Its IUPAC name is N'-[2-[[4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[[4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 25476646 |
| Molecular Formula | C24H23N5O2S2 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N'-[2-[[4-(2-phenylethyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1nnc(Cc2cccs2)n1CCc1ccccc1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23N5O2S2/c30-22(26-27-23(31)19-10-5-2-6-11-19)17-33-24-28-25-21(16-20-12-7-15-32-20)29(24)14-13-18-8-3-1-4-9-18/h1-12,15H,13-14,16-17H2,(H,26,30)(H,27,31) |
| InChIKey | JZFMFPDTKHTCKK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|