C12H11N5O2S — CID 63580694
2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)furan-3-carbohydrazide (PubChem CID 63580694) has the molecular formula C12H11N5O2S and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)furan-3-carbohydrazide.
| Compound Name | 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)furan-3-carbohydrazide |
|---|---|
| PubChem CID | 63580694 |
| Molecular Formula | C12H11N5O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)furan-3-carbohydrazide |
| SMILES | NNC(=O)c1ccoc1CSc1nnc2ccccn12 |
| InChI | InChI=1S/C12H11N5O2S/c13-14-11(18)8-4-6-19-9(8)7-20-12-16-15-10-3-1-2-5-17(10)12/h1-6H,7,13H2,(H,14,18) |
| InChIKey | DVVUPKFYXUIFET-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|