methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate

C10H11N3O2S — CID 15627151

IUPACmethyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate
SMILESCOC(=O)CCSc1nnc2ccccn12
InChIInChI=1S/C10H11N3O2S/c1-15-9(14)5-7-16-10-12-11-8-4-2-3-6-13(8)10/h2-4,6H,5,7H2,1H3
InChIKeyOXJRTKXVBNPPCM-UHFFFAOYSA-N
MW237.28 g/mol
LogP1.38
Rot. Bonds4

About methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate

methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate (PubChem CID 15627151) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate.

Molecular Properties

Compound Namemethyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate
PubChem CID15627151
Molecular FormulaC10H11N3O2S
Molecular Weight237.28 g/mol
Exact Mass237.06
IUPAC Namemethyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate
SMILESCOC(=O)CCSc1nnc2ccccn12
InChIInChI=1S/C10H11N3O2S/c1-15-9(14)5-7-16-10-12-11-8-4-2-3-6-13(8)10/h2-4,6H,5,7H2,1H3
InChIKeyOXJRTKXVBNPPCM-UHFFFAOYSA-N
XLogP1.38
TPSA56.49 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.28
LogP ≤ 51.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate?
The IUPAC name of methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate (CID 15627151) is methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate.
What is the SMILES notation for methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate?
The canonical SMILES for methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate is COC(=O)CCSc1nnc2ccccn12.
What is the InChIKey of methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate?
The InChIKey is OXJRTKXVBNPPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S/c1-15-9(14)5-7-16-10-12-11-8-4-2-3-6-13(8)10/h2-4,6H,5,7H2,1H3.
What are the key properties of methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate?
methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate has a molecular weight of 237.28 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propanoate is sourced from PubChem (CID 15627151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).