C12H18N4S — CID 62848594
N-propan-2-yl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propan-1-amine (PubChem CID 62848594) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is N-propan-2-yl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propan-1-amine.
| Compound Name | N-propan-2-yl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propan-1-amine |
|---|---|
| PubChem CID | 62848594 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-propan-2-yl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)propan-1-amine |
| SMILES | CC(C)NCCCSc1nnc2ccccn12 |
| InChI | InChI=1S/C12H18N4S/c1-10(2)13-7-5-9-17-12-15-14-11-6-3-4-8-16(11)12/h3-4,6,8,10,13H,5,7,9H2,1-2H3 |
| InChIKey | SYGRWTLNAHWUDM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|