C8H8N6S — CID 55209832
3-(2-azidoethylsulfanyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 55209832) has the molecular formula C8H8N6S and a molecular weight of 220.26 g/mol. Its IUPAC name is 3-(2-azidoethylsulfanyl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(2-azidoethylsulfanyl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 55209832 |
| Molecular Formula | C8H8N6S |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 3-(2-azidoethylsulfanyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | [N-]=[N+]=NCCSc1nnc2ccccn12 |
| InChI | InChI=1S/C8H8N6S/c9-13-10-4-6-15-8-12-11-7-3-1-2-5-14(7)8/h1-3,5H,4,6H2 |
| InChIKey | VOAVNOBHWNDXFH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|