C10H11N3S2 — CID 103074186
2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)prop-2-ene-1-thiol (PubChem CID 103074186) has the molecular formula C10H11N3S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)prop-2-ene-1-thiol.
| Compound Name | 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103074186 |
| Molecular Formula | C10H11N3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)prop-2-ene-1-thiol |
| SMILES | C=C(CS)CSc1nnc2ccccn12 |
| InChI | InChI=1S/C10H11N3S2/c1-8(6-14)7-15-10-12-11-9-4-2-3-5-13(9)10/h2-5,14H,1,6-7H2 |
| InChIKey | SNYYSLGNGVKWOF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|