C10H10ClN3S — CID 103066297
3-[2-(chloromethyl)prop-2-enylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 103066297) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 3-[2-(chloromethyl)prop-2-enylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[2-(chloromethyl)prop-2-enylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 103066297 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 3-[2-(chloromethyl)prop-2-enylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | C=C(CCl)CSc1nnc2ccccn12 |
| InChI | InChI=1S/C10H10ClN3S/c1-8(6-11)7-15-10-13-12-9-4-2-3-5-14(9)10/h2-5H,1,6-7H2 |
| InChIKey | VQHRNHJWMFSWOZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|