C13H13ClN4S2 — CID 62848433
N-[(5-chlorothiophen-2-yl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethanamine (PubChem CID 62848433) has the molecular formula C13H13ClN4S2 and a molecular weight of 324.86 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 62848433 |
| Molecular Formula | C13H13ClN4S2 |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)ethanamine |
| SMILES | Clc1ccc(CNCCSc2nnc3ccccn23)s1 |
| InChI | InChI=1S/C13H13ClN4S2/c14-11-5-4-10(20-11)9-15-6-8-19-13-17-16-12-3-1-2-7-18(12)13/h1-5,7,15H,6,8-9H2 |
| InChIKey | AABPNWGXTCJJDU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|