C10H11ClN2OS2 — CID 106925799
N-[(5-chlorothiophen-2-yl)methyl]-2-(1,3-oxazol-2-ylsulfanyl)ethanamine (PubChem CID 106925799) has the molecular formula C10H11ClN2OS2 and a molecular weight of 274.80 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-(1,3-oxazol-2-ylsulfanyl)ethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(1,3-oxazol-2-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 106925799 |
| Molecular Formula | C10H11ClN2OS2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-(1,3-oxazol-2-ylsulfanyl)ethanamine |
| SMILES | Clc1ccc(CNCCSc2ncco2)s1 |
| InChI | InChI=1S/C10H11ClN2OS2/c11-9-2-1-8(16-9)7-12-4-6-15-10-13-3-5-14-10/h1-3,5,12H,4,6-7H2 |
| InChIKey | YOJHMXQKNQRMBK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|