C9H14ClNS2 — CID 62576712
N-[(5-chlorothiophen-2-yl)methyl]-2-ethylsulfanylethanamine (PubChem CID 62576712) has the molecular formula C9H14ClNS2 and a molecular weight of 235.80 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-ethylsulfanylethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-ethylsulfanylethanamine |
|---|---|
| PubChem CID | 62576712 |
| Molecular Formula | C9H14ClNS2 |
| Molecular Weight | 235.80 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-ethylsulfanylethanamine |
| SMILES | CCSCCNCc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H14ClNS2/c1-2-12-6-5-11-7-8-3-4-9(10)13-8/h3-4,11H,2,5-7H2,1H3 |
| InChIKey | NWKJSLWPICXTBQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.80 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|