C11H19ClN2S — CID 28580132
N-[(5-chlorothiophen-2-yl)methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 28580132) has the molecular formula C11H19ClN2S and a molecular weight of 246.81 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 28580132 |
| Molecular Formula | C11H19ClN2S |
| Molecular Weight | 246.81 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H19ClN2S/c1-3-14(4-2)8-7-13-9-10-5-6-11(12)15-10/h5-6,13H,3-4,7-9H2,1-2H3 |
| InChIKey | APDGMACCHBSVTN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.81 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|