C12H21ClN2S — CID 106046261
N-[2-(5-chlorothiophen-2-yl)ethyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 106046261) has the molecular formula C12H21ClN2S and a molecular weight of 260.83 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 106046261 |
| Molecular Formula | C12H21ClN2S |
| Molecular Weight | 260.83 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H21ClN2S/c1-3-15(4-2)10-9-14-8-7-11-5-6-12(13)16-11/h5-6,14H,3-4,7-10H2,1-2H3 |
| InChIKey | GIVNHINQLUDIAD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.83 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|