C10H16ClNO2S2 — CID 106046353
N-[2-(5-chlorothiophen-2-yl)ethyl]-3-methylsulfonylpropan-1-amine (PubChem CID 106046353) has the molecular formula C10H16ClNO2S2 and a molecular weight of 281.83 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-3-methylsulfonylpropan-1-amine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 106046353 |
| Molecular Formula | C10H16ClNO2S2 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-3-methylsulfonylpropan-1-amine |
| SMILES | CS(=O)(=O)CCCNCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H16ClNO2S2/c1-16(13,14)8-2-6-12-7-5-9-3-4-10(11)15-9/h3-4,12H,2,5-8H2,1H3 |
| InChIKey | UQQYDNMRNQKSAB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|