C12H16ClN3S — CID 114140354
N-[2-(5-chlorothiophen-2-yl)ethyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 114140354) has the molecular formula C12H16ClN3S and a molecular weight of 269.80 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 114140354 |
| Molecular Formula | C12H16ClN3S |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | Clc1ccc(CCNCCCn2ccnc2)s1 |
| InChI | InChI=1S/C12H16ClN3S/c13-12-3-2-11(17-12)4-6-14-5-1-8-16-9-7-15-10-16/h2-3,7,9-10,14H,1,4-6,8H2 |
| InChIKey | GTBJNQVCPVGSQI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|