C8H10ClF2NS — CID 106046426
N-[2-(5-chlorothiophen-2-yl)ethyl]-2,2-difluoroethanamine (PubChem CID 106046426) has the molecular formula C8H10ClF2NS and a molecular weight of 225.69 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-2,2-difluoroethanamine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 106046426 |
| Molecular Formula | C8H10ClF2NS |
| Molecular Weight | 225.69 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CNCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H10ClF2NS/c9-7-2-1-6(13-7)3-4-12-5-8(10)11/h1-2,8,12H,3-5H2 |
| InChIKey | HFQXFFNJNKQBFO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.69 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|