C17H23ClN2S — CID 29047393
N-[[4-[[(5-chlorothiophen-2-yl)methylamino]methyl]phenyl]methyl]-N-ethylethanamine (PubChem CID 29047393) has the molecular formula C17H23ClN2S and a molecular weight of 322.91 g/mol. Its IUPAC name is N-[[4-[[(5-chlorothiophen-2-yl)methylamino]methyl]phenyl]methyl]-N-ethylethanamine.
| Compound Name | N-[[4-[[(5-chlorothiophen-2-yl)methylamino]methyl]phenyl]methyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 29047393 |
| Molecular Formula | C17H23ClN2S |
| Molecular Weight | 322.91 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[[4-[[(5-chlorothiophen-2-yl)methylamino]methyl]phenyl]methyl]-N-ethylethanamine |
| SMILES | CCN(CC)Cc1ccc(CNCc2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C17H23ClN2S/c1-3-20(4-2)13-15-7-5-14(6-8-15)11-19-12-16-9-10-17(18)21-16/h5-10,19H,3-4,11-13H2,1-2H3 |
| InChIKey | QMYSMMJVWMJMND-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.91 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |