C15H18Cl2N2S — CID 62556355
N'-[(4-chlorophenyl)methyl]-N-[(5-chlorothiophen-2-yl)methyl]-N'-methylethane-1,2-diamine (PubChem CID 62556355) has the molecular formula C15H18Cl2N2S and a molecular weight of 329.30 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methyl]-N-[(5-chlorothiophen-2-yl)methyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-[(4-chlorophenyl)methyl]-N-[(5-chlorothiophen-2-yl)methyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62556355 |
| Molecular Formula | C15H18Cl2N2S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N'-[(4-chlorophenyl)methyl]-N-[(5-chlorothiophen-2-yl)methyl]-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNCc1ccc(Cl)s1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18Cl2N2S/c1-19(11-12-2-4-13(16)5-3-12)9-8-18-10-14-6-7-15(17)20-14/h2-7,18H,8-11H2,1H3 |
| InChIKey | WFMNRYCZUQSIIK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|