C14H25ClN2S — CID 62554509
N-[(5-chlorothiophen-2-yl)methyl]-N'-(3,3-dimethylbutan-2-yl)-N'-methylethane-1,2-diamine (PubChem CID 62554509) has the molecular formula C14H25ClN2S and a molecular weight of 288.89 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N'-(3,3-dimethylbutan-2-yl)-N'-methylethane-1,2-diamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N'-(3,3-dimethylbutan-2-yl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62554509 |
| Molecular Formula | C14H25ClN2S |
| Molecular Weight | 288.89 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N'-(3,3-dimethylbutan-2-yl)-N'-methylethane-1,2-diamine |
| SMILES | CC(N(C)CCNCc1ccc(Cl)s1)C(C)(C)C |
| InChI | InChI=1S/C14H25ClN2S/c1-11(14(2,3)4)17(5)9-8-16-10-12-6-7-13(15)18-12/h6-7,11,16H,8-10H2,1-5H3 |
| InChIKey | XMWMWWZNJNSYON-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.89 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|