C15H19ClN2S — CID 62554583
N-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-N'-(4-methylphenyl)ethane-1,2-diamine (PubChem CID 62554583) has the molecular formula C15H19ClN2S and a molecular weight of 294.85 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-N'-(4-methylphenyl)ethane-1,2-diamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-N'-(4-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62554583 |
| Molecular Formula | C15H19ClN2S |
| Molecular Weight | 294.85 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N'-methyl-N'-(4-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1ccc(N(C)CCNCc2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C15H19ClN2S/c1-12-3-5-13(6-4-12)18(2)10-9-17-11-14-7-8-15(16)19-14/h3-8,17H,9-11H2,1-2H3 |
| InChIKey | RKWSFUTZYPAAKP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.85 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|