C16H21ClN2S — CID 63502732
N-[(5-chlorothiophen-2-yl)methyl]-N'-(2,4-dimethylphenyl)-N'-methylethane-1,2-diamine (PubChem CID 63502732) has the molecular formula C16H21ClN2S and a molecular weight of 308.88 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N'-(2,4-dimethylphenyl)-N'-methylethane-1,2-diamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N'-(2,4-dimethylphenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 63502732 |
| Molecular Formula | C16H21ClN2S |
| Molecular Weight | 308.88 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N'-(2,4-dimethylphenyl)-N'-methylethane-1,2-diamine |
| SMILES | Cc1ccc(N(C)CCNCc2ccc(Cl)s2)c(C)c1 |
| InChI | InChI=1S/C16H21ClN2S/c1-12-4-6-15(13(2)10-12)19(3)9-8-18-11-14-5-7-16(17)20-14/h4-7,10,18H,8-9,11H2,1-3H3 |
| InChIKey | IQJQLSKRXWOVSO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|