C14H15Cl2NS — CID 114054620
2-(chloromethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N,4-dimethylaniline (PubChem CID 114054620) has the molecular formula C14H15Cl2NS and a molecular weight of 300.25 g/mol. Its IUPAC name is 2-(chloromethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N,4-dimethylaniline.
| Compound Name | 2-(chloromethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N,4-dimethylaniline |
|---|---|
| PubChem CID | 114054620 |
| Molecular Formula | C14H15Cl2NS |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2-(chloromethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N,4-dimethylaniline |
| SMILES | Cc1ccc(N(C)Cc2ccc(Cl)s2)c(CCl)c1 |
| InChI | InChI=1S/C14H15Cl2NS/c1-10-3-5-13(11(7-10)8-15)17(2)9-12-4-6-14(16)18-12/h3-7H,8-9H2,1-2H3 |
| InChIKey | MQHYYTXNYDUNMG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|