C13H11ClF2N2S2 — CID 107934643
4-[(5-chlorothiophen-2-yl)methyl-methylamino]-2,3-difluorobenzenecarbothioamide (PubChem CID 107934643) has the molecular formula C13H11ClF2N2S2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl-methylamino]-2,3-difluorobenzenecarbothioamide.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl-methylamino]-2,3-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107934643 |
| Molecular Formula | C13H11ClF2N2S2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl-methylamino]-2,3-difluorobenzenecarbothioamide |
| SMILES | CN(Cc1ccc(Cl)s1)c1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C13H11ClF2N2S2/c1-18(6-7-2-5-10(14)20-7)9-4-3-8(13(17)19)11(15)12(9)16/h2-5H,6H2,1H3,(H2,17,19) |
| InChIKey | SUTRWCWIHJVKMM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|