C15H17ClN2OS2 — CID 106788790
4-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-2-methoxybenzenecarbothioamide (PubChem CID 106788790) has the molecular formula C15H17ClN2OS2 and a molecular weight of 340.90 g/mol. Its IUPAC name is 4-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-2-methoxybenzenecarbothioamide.
| Compound Name | 4-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-2-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 106788790 |
| Molecular Formula | C15H17ClN2OS2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-2-methoxybenzenecarbothioamide |
| SMILES | COc1cc(CN(C)Cc2ccc(Cl)s2)ccc1C(N)=S |
| InChI | InChI=1S/C15H17ClN2OS2/c1-18(9-11-4-6-14(16)21-11)8-10-3-5-12(15(17)20)13(7-10)19-2/h3-7H,8-9H2,1-2H3,(H2,17,20) |
| InChIKey | UMRWMYZUSLWKSM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|