C16H22ClNSSi — CID 103438323
N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-(4-trimethylsilylphenyl)methanamine (PubChem CID 103438323) has the molecular formula C16H22ClNSSi and a molecular weight of 323.97 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-(4-trimethylsilylphenyl)methanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-(4-trimethylsilylphenyl)methanamine |
|---|---|
| PubChem CID | 103438323 |
| Molecular Formula | C16H22ClNSSi |
| Molecular Weight | 323.97 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-(4-trimethylsilylphenyl)methanamine |
| SMILES | CN(Cc1ccc([Si](C)(C)C)cc1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H22ClNSSi/c1-18(12-14-7-10-16(17)19-14)11-13-5-8-15(9-6-13)20(2,3)4/h5-10H,11-12H2,1-4H3 |
| InChIKey | MKHHGBAPOSKGLN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.97 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|