C7H9BClF3NS- — CID 63705419
[(5-chlorothiophen-2-yl)methyl-methylamino]methyl-trifluoroboranuide (PubChem CID 63705419) has the molecular formula C7H9BClF3NS- and a molecular weight of 242.48 g/mol. Its IUPAC name is [(5-chlorothiophen-2-yl)methyl-methylamino]methyl-trifluoroboranuide.
| Compound Name | [(5-chlorothiophen-2-yl)methyl-methylamino]methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 63705419 |
| Molecular Formula | C7H9BClF3NS- |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | [(5-chlorothiophen-2-yl)methyl-methylamino]methyl-trifluoroboranuide |
| SMILES | CN(Cc1ccc(Cl)s1)C[B-](F)(F)F |
| InChI | InChI=1S/C7H9BClF3NS/c1-13(5-8(10,11)12)4-6-2-3-7(9)14-6/h2-3H,4-5H2,1H3/q-1 |
| InChIKey | RNIMLSVCZFQXQY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|