C13H12ClF3N2S — CID 61438246
1-N-[(5-chlorothiophen-2-yl)methyl]-1-N-methyl-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 61438246) has the molecular formula C13H12ClF3N2S and a molecular weight of 320.77 g/mol. Its IUPAC name is 1-N-[(5-chlorothiophen-2-yl)methyl]-1-N-methyl-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-[(5-chlorothiophen-2-yl)methyl]-1-N-methyl-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 61438246 |
| Molecular Formula | C13H12ClF3N2S |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-N-[(5-chlorothiophen-2-yl)methyl]-1-N-methyl-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CN(Cc1ccc(Cl)s1)c1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C13H12ClF3N2S/c1-19(7-9-3-5-12(14)20-9)11-4-2-8(18)6-10(11)13(15,16)17/h2-6H,7,18H2,1H3 |
| InChIKey | INAOEIXXGGXDPC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|