C10H11F3N2O2 — CID 62255633
2-[4-amino-N-methyl-2-(trifluoromethyl)anilino]acetic acid (PubChem CID 62255633) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2-[4-amino-N-methyl-2-(trifluoromethyl)anilino]acetic acid.
| Compound Name | 2-[4-amino-N-methyl-2-(trifluoromethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 62255633 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-[4-amino-N-methyl-2-(trifluoromethyl)anilino]acetic acid |
| SMILES | CN(CC(=O)O)c1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O2/c1-15(5-9(16)17)8-3-2-6(14)4-7(8)10(11,12)13/h2-4H,5,14H2,1H3,(H,16,17) |
| InChIKey | OHAQKRSUOMTQTE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|