C14H19F3N2O — CID 61431772
1-N-methyl-1-N-(oxan-2-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 61431772) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-N-methyl-1-N-(oxan-2-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-methyl-1-N-(oxan-2-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 61431772 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-N-methyl-1-N-(oxan-2-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CN(CC1CCCCO1)c1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O/c1-19(9-11-4-2-3-7-20-11)13-6-5-10(18)8-12(13)14(15,16)17/h5-6,8,11H,2-4,7,9,18H2,1H3 |
| InChIKey | UNGZOIIJJZWWFS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|