C14H16BrFN2O — CID 107533332
2-bromo-3-fluoro-4-[methyl(oxan-2-ylmethyl)amino]benzonitrile (PubChem CID 107533332) has the molecular formula C14H16BrFN2O and a molecular weight of 327.20 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[methyl(oxan-2-ylmethyl)amino]benzonitrile.
| Compound Name | 2-bromo-3-fluoro-4-[methyl(oxan-2-ylmethyl)amino]benzonitrile |
|---|---|
| PubChem CID | 107533332 |
| Molecular Formula | C14H16BrFN2O |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-bromo-3-fluoro-4-[methyl(oxan-2-ylmethyl)amino]benzonitrile |
| SMILES | CN(CC1CCCCO1)c1ccc(C#N)c(Br)c1F |
| InChI | InChI=1S/C14H16BrFN2O/c1-18(9-11-4-2-3-7-19-11)12-6-5-10(8-17)13(15)14(12)16/h5-6,11H,2-4,7,9H2,1H3 |
| InChIKey | HLOWTFGSEUMHRZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |