C13H15FN2O — CID 113295571
2-fluoro-4-[methyl(oxolan-2-ylmethyl)amino]benzonitrile (PubChem CID 113295571) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 2-fluoro-4-[methyl(oxolan-2-ylmethyl)amino]benzonitrile.
| Compound Name | 2-fluoro-4-[methyl(oxolan-2-ylmethyl)amino]benzonitrile |
|---|---|
| PubChem CID | 113295571 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-fluoro-4-[methyl(oxolan-2-ylmethyl)amino]benzonitrile |
| SMILES | CN(CC1CCCO1)c1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C13H15FN2O/c1-16(9-12-3-2-6-17-12)11-5-4-10(8-15)13(14)7-11/h4-5,7,12H,2-3,6,9H2,1H3 |
| InChIKey | AHBDMNZMOBPXLL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |