C13H17BrFNO — CID 107081234
4-(bromomethyl)-2-fluoro-N-methyl-N-(oxolan-2-ylmethyl)aniline (PubChem CID 107081234) has the molecular formula C13H17BrFNO and a molecular weight of 302.19 g/mol. Its IUPAC name is 4-(bromomethyl)-2-fluoro-N-methyl-N-(oxolan-2-ylmethyl)aniline.
| Compound Name | 4-(bromomethyl)-2-fluoro-N-methyl-N-(oxolan-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 107081234 |
| Molecular Formula | C13H17BrFNO |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 4-(bromomethyl)-2-fluoro-N-methyl-N-(oxolan-2-ylmethyl)aniline |
| SMILES | CN(CC1CCCO1)c1ccc(CBr)cc1F |
| InChI | InChI=1S/C13H17BrFNO/c1-16(9-11-3-2-6-17-11)13-5-4-10(8-14)7-12(13)15/h4-5,7,11H,2-3,6,8-9H2,1H3 |
| InChIKey | GKDBVHYWIDGQDV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|