C11H13BrFN — CID 107079857
4-(bromomethyl)-N-cyclopropyl-2-fluoro-N-methylaniline (PubChem CID 107079857) has the molecular formula C11H13BrFN and a molecular weight of 258.13 g/mol. Its IUPAC name is 4-(bromomethyl)-N-cyclopropyl-2-fluoro-N-methylaniline.
| Compound Name | 4-(bromomethyl)-N-cyclopropyl-2-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 107079857 |
| Molecular Formula | C11H13BrFN |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 4-(bromomethyl)-N-cyclopropyl-2-fluoro-N-methylaniline |
| SMILES | CN(c1ccc(CBr)cc1F)C1CC1 |
| InChI | InChI=1S/C11H13BrFN/c1-14(9-3-4-9)11-5-2-8(7-12)6-10(11)13/h2,5-6,9H,3-4,7H2,1H3 |
| InChIKey | IHBFFHPYAICLQF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|