C13H16BrF2N — CID 107079915
4-(bromomethyl)-N-cyclopentyl-2,6-difluoro-N-methylaniline (PubChem CID 107079915) has the molecular formula C13H16BrF2N and a molecular weight of 304.18 g/mol. Its IUPAC name is 4-(bromomethyl)-N-cyclopentyl-2,6-difluoro-N-methylaniline.
| Compound Name | 4-(bromomethyl)-N-cyclopentyl-2,6-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 107079915 |
| Molecular Formula | C13H16BrF2N |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 4-(bromomethyl)-N-cyclopentyl-2,6-difluoro-N-methylaniline |
| SMILES | CN(c1c(F)cc(CBr)cc1F)C1CCCC1 |
| InChI | InChI=1S/C13H16BrF2N/c1-17(10-4-2-3-5-10)13-11(15)6-9(8-14)7-12(13)16/h6-7,10H,2-5,8H2,1H3 |
| InChIKey | QFBMKAVTKLFBBI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|