C13H15BrF2O — CID 79888123
5-(bromomethyl)-2-cyclohexyloxy-1,3-difluorobenzene (PubChem CID 79888123) has the molecular formula C13H15BrF2O and a molecular weight of 305.16 g/mol. Its IUPAC name is 5-(bromomethyl)-2-cyclohexyloxy-1,3-difluorobenzene.
| Compound Name | 5-(bromomethyl)-2-cyclohexyloxy-1,3-difluorobenzene |
|---|---|
| PubChem CID | 79888123 |
| Molecular Formula | C13H15BrF2O |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 5-(bromomethyl)-2-cyclohexyloxy-1,3-difluorobenzene |
| SMILES | Fc1cc(CBr)cc(F)c1OC1CCCCC1 |
| InChI | InChI=1S/C13H15BrF2O/c14-8-9-6-11(15)13(12(16)7-9)17-10-4-2-1-3-5-10/h6-7,10H,1-5,8H2 |
| InChIKey | JDFKLEGGZFYUSA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|