C12H13F2NOS — CID 81286677
4-cyclopentyloxy-3,5-difluorobenzenecarbothioamide (PubChem CID 81286677) has the molecular formula C12H13F2NOS and a molecular weight of 257.30 g/mol. Its IUPAC name is 4-cyclopentyloxy-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-cyclopentyloxy-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 81286677 |
| Molecular Formula | C12H13F2NOS |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-cyclopentyloxy-3,5-difluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)c(OC2CCCC2)c(F)c1 |
| InChI | InChI=1S/C12H13F2NOS/c13-9-5-7(12(15)17)6-10(14)11(9)16-8-3-1-2-4-8/h5-6,8H,1-4H2,(H2,15,17) |
| InChIKey | NMIHEXDSEQBAME-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|