C14H16F2N2S — CID 115559950
4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,5-difluorobenzenecarbothioamide (PubChem CID 115559950) has the molecular formula C14H16F2N2S and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,5-difluorobenzenecarbothioamide.
| Compound Name | 4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,5-difluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 115559950 |
| Molecular Formula | C14H16F2N2S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3,5-difluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)c(N2CC3CCCC3C2)c(F)c1 |
| InChI | InChI=1S/C14H16F2N2S/c15-11-4-10(14(17)19)5-12(16)13(11)18-6-8-2-1-3-9(8)7-18/h4-5,8-9H,1-3,6-7H2,(H2,17,19) |
| InChIKey | OUQMMPQNACJJBV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|