C14H19F2N3S — CID 81286661
3,5-difluoro-4-(3,3,4-trimethylpiperazin-1-yl)benzenecarbothioamide (PubChem CID 81286661) has the molecular formula C14H19F2N3S and a molecular weight of 299.39 g/mol. Its IUPAC name is 3,5-difluoro-4-(3,3,4-trimethylpiperazin-1-yl)benzenecarbothioamide.
| Compound Name | 3,5-difluoro-4-(3,3,4-trimethylpiperazin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 81286661 |
| Molecular Formula | C14H19F2N3S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3,5-difluoro-4-(3,3,4-trimethylpiperazin-1-yl)benzenecarbothioamide |
| SMILES | CN1CCN(c2c(F)cc(C(N)=S)cc2F)CC1(C)C |
| InChI | InChI=1S/C14H19F2N3S/c1-14(2)8-19(5-4-18(14)3)12-10(15)6-9(13(17)20)7-11(12)16/h6-7H,4-5,8H2,1-3H3,(H2,17,20) |
| InChIKey | FUWCVVMCVUGVKS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|